C12H15BrClN3O — CID 146537945
3-[[(5-bromo-4-chloro-2-pyridinyl)amino]methyl]pentyl cyanate (PubChem CID 146537945) has the molecular formula C12H15BrClN3O and a molecular weight of 332.63 g/mol. Its IUPAC name is 3-[[(5-bromo-4-chloro-2-pyridinyl)amino]methyl]pentyl cyanate.
| Compound Name | 3-[[(5-bromo-4-chloro-2-pyridinyl)amino]methyl]pentyl cyanate |
|---|---|
| PubChem CID | 146537945 |
| Molecular Formula | C12H15BrClN3O |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 3-[[(5-bromo-4-chloro-2-pyridinyl)amino]methyl]pentyl cyanate |
| SMILES | CCC(CCOC#N)CNc1cc(Cl)c(Br)cn1 |
| InChI | InChI=1S/C12H15BrClN3O/c1-2-9(3-4-18-8-15)6-16-12-5-11(14)10(13)7-17-12/h5,7,9H,2-4,6H2,1H3,(H,16,17) |
| InChIKey | ZQEQQNSUTAYTLE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|