C22H21ClN4O3 — CID 146539568
6-[4-[4-chloro-2-methanimidoyl-3-(methylamino)phenoxy]phenyl]-4-(2-hydroxyethyl)pyridine-2-carboxamide (PubChem CID 146539568) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is 6-[4-[4-chloro-2-methanimidoyl-3-(methylamino)phenoxy]phenyl]-4-(2-hydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 6-[4-[4-chloro-2-methanimidoyl-3-(methylamino)phenoxy]phenyl]-4-(2-hydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146539568 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 6-[4-[4-chloro-2-methanimidoyl-3-(methylamino)phenoxy]phenyl]-4-(2-hydroxyethyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1c(Oc2ccc(-c3cc(CCO)cc(C(N)=O)n3)cc2)ccc(Cl)c1NC |
| InChI | InChI=1S/C22H21ClN4O3/c1-26-21-16(12-24)20(7-6-17(21)23)30-15-4-2-14(3-5-15)18-10-13(8-9-28)11-19(27-18)22(25)29/h2-7,10-12,24,26,28H,8-9H2,1H3,(H2,25,29)/b24-12+ |
| InChIKey | KWSQPHUSDAQUFC-WYMPLXKRSA-N |
| XLogP | 3.87 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|