C17H20N4O2 — CID 171820164
5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)-6-(methylamino)pyridine-2-carboxamide (PubChem CID 171820164) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | 5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171820164 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)-6-(methylamino)pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1c(-c2c(C)ccc(OC)c2C)cc(C(N)=O)nc1NC |
| InChI | InChI=1S/C17H20N4O2/c1-9-5-6-14(23-4)10(2)15(9)11-7-13(16(19)22)21-17(20-3)12(11)8-18/h5-8,18H,1-4H3,(H2,19,22)(H,20,21)/b18-8+ |
| InChIKey | HJIHUBZRWFANGA-QGMBQPNBSA-N |
| XLogP | 2.51 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|