C18H23N5O2 — CID 171820315
3-amino-6-(ethylamino)-5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)pyridine-2-carboxamide (PubChem CID 171820315) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-amino-6-(ethylamino)-5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-6-(ethylamino)-5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171820315 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-amino-6-(ethylamino)-5-methanimidoyl-4-(3-methoxy-2,6-dimethylphenyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1c(NCC)nc(C(N)=O)c(N)c1-c1c(C)ccc(OC)c1C |
| InChI | InChI=1S/C18H23N5O2/c1-5-22-18-11(8-19)14(15(20)16(23-18)17(21)24)13-9(2)6-7-12(25-4)10(13)3/h6-8,19H,5,20H2,1-4H3,(H2,21,24)(H,22,23)/b19-8+ |
| InChIKey | MLRPHQABABLGKV-UFWORHAWSA-N |
| XLogP | 2.48 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|