C19H21N3O3 — CID 171645244
ethyl 3-amino-6-ethenyl-4-(3-methoxy-2-methylphenyl)-5-(methylideneamino)pyridine-2-carboxylate (PubChem CID 171645244) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 3-amino-6-ethenyl-4-(3-methoxy-2-methylphenyl)-5-(methylideneamino)pyridine-2-carboxylate.
| Compound Name | ethyl 3-amino-6-ethenyl-4-(3-methoxy-2-methylphenyl)-5-(methylideneamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171645244 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 3-amino-6-ethenyl-4-(3-methoxy-2-methylphenyl)-5-(methylideneamino)pyridine-2-carboxylate |
| SMILES | C=Cc1nc(C(=O)OCC)c(N)c(-c2cccc(OC)c2C)c1N=C |
| InChI | InChI=1S/C19H21N3O3/c1-6-13-17(21-4)15(12-9-8-10-14(24-5)11(12)3)16(20)18(22-13)19(23)25-7-2/h6,8-10H,1,4,7,20H2,2-3,5H3 |
| InChIKey | ISJMZMLEVNJRNL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|