C14H15NO4S — CID 53271349
ethyl 5-(2,3-dimethoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 53271349) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is ethyl 5-(2,3-dimethoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(2,3-dimethoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 53271349 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | ethyl 5-(2,3-dimethoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1-c1cccc(OC)c1OC |
| InChI | InChI=1S/C14H15NO4S/c1-4-19-14(16)11-13(20-8-15-11)9-6-5-7-10(17-2)12(9)18-3/h5-8H,4H2,1-3H3 |
| InChIKey | TZSQXYDSZIJYEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |