C19H17F3N4O2 — CID 171645325
7-amino-8-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)quinoxaline-6-carboxamide (PubChem CID 171645325) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 7-amino-8-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)quinoxaline-6-carboxamide.
| Compound Name | 7-amino-8-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 171645325 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 7-amino-8-(3-methoxy-2,6-dimethylphenyl)-3-(trifluoromethyl)quinoxaline-6-carboxamide |
| SMILES | COc1ccc(C)c(-c2c(N)c(C(N)=O)cc3nc(C(F)(F)F)cnc23)c1C |
| InChI | InChI=1S/C19H17F3N4O2/c1-8-4-5-12(28-3)9(2)14(8)15-16(23)10(18(24)27)6-11-17(15)25-7-13(26-11)19(20,21)22/h4-7H,23H2,1-3H3,(H2,24,27) |
| InChIKey | FLCZCUKVJZYCFH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|