C25H23N3O3S — CID 146541441
N-[4-[4-[(2,6-dimethylquinolin-4-yl)amino]phenyl]sulfonylphenyl]acetamide (PubChem CID 146541441) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[4-[4-[(2,6-dimethylquinolin-4-yl)amino]phenyl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[(2,6-dimethylquinolin-4-yl)amino]phenyl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 146541441 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[4-[4-[(2,6-dimethylquinolin-4-yl)amino]phenyl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(Nc3cc(C)nc4ccc(C)cc34)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-16-4-13-24-23(14-16)25(15-17(2)26-24)28-20-7-11-22(12-8-20)32(30,31)21-9-5-19(6-10-21)27-18(3)29/h4-15H,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | HFXUMQGSARRBLU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |