C25H29ClN2O5S — CID 146545474
(4S)-7-chloro-5'-[[(1R,2R)-2-[(1R)-1-hydroxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-sulfonamide (PubChem CID 146545474) has the molecular formula C25H29ClN2O5S and a molecular weight of 505.04 g/mol. Its IUPAC name is (4S)-7-chloro-5'-[[(1R,2R)-2-[(1R)-1-hydroxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-sulfonamide.
| Compound Name | (4S)-7-chloro-5'-[[(1R,2R)-2-[(1R)-1-hydroxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-sulfonamide |
|---|---|
| PubChem CID | 146545474 |
| Molecular Formula | C25H29ClN2O5S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (4S)-7-chloro-5'-[[(1R,2R)-2-[(1R)-1-hydroxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-sulfonamide |
| SMILES | C=C[C@@H](O)[C@@H]1CC[C@H]1CN1C[C@@]2(CCOc3cc(Cl)ccc32)COc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C25H29ClN2O5S/c1-2-22(29)19-6-3-16(19)13-28-14-25(9-10-32-24-11-17(26)4-7-20(24)25)15-33-23-8-5-18(12-21(23)28)34(27,30)31/h2,4-5,7-8,11-12,16,19,22,29H,1,3,6,9-10,13-15H2,(H2,27,30,31)/t16-,19+,22+,25-/m0/s1 |
| InChIKey | WCDKDPSMEMOPCP-IVTZASDFSA-N |
| XLogP | 3.48 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|