C19H14Cl2FNO3S — CID 146545770
3,5-dichloro-N-[(2-fluoro-5-phenylphenyl)methyl]-2-hydroxybenzenesulfonamide (PubChem CID 146545770) has the molecular formula C19H14Cl2FNO3S and a molecular weight of 426.30 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2-fluoro-5-phenylphenyl)methyl]-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[(2-fluoro-5-phenylphenyl)methyl]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 146545770 |
| Molecular Formula | C19H14Cl2FNO3S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 3,5-dichloro-N-[(2-fluoro-5-phenylphenyl)methyl]-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccccc2)ccc1F)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H14Cl2FNO3S/c20-15-9-16(21)19(24)18(10-15)27(25,26)23-11-14-8-13(6-7-17(14)22)12-4-2-1-3-5-12/h1-10,23-24H,11H2 |
| InChIKey | HWHSERWUHORIPI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|