C25H18BrClFNO3S — CID 146545789
N-benzyl-3-bromo-5-chloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide (PubChem CID 146545789) has the molecular formula C25H18BrClFNO3S and a molecular weight of 546.85 g/mol. Its IUPAC name is N-benzyl-3-bromo-5-chloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide.
| Compound Name | N-benzyl-3-bromo-5-chloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 146545789 |
| Molecular Formula | C25H18BrClFNO3S |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | N-benzyl-3-bromo-5-chloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(c1cc(Cl)cc(Br)c1O)N(Cc1ccccc1)c1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C25H18BrClFNO3S/c26-21-14-20(27)15-24(25(21)30)33(31,32)29(16-17-7-3-1-4-8-17)23-13-19(11-12-22(23)28)18-9-5-2-6-10-18/h1-15,30H,16H2 |
| InChIKey | QXGJZDNNCPVOSK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|