C20H15BrClNO3S — CID 146565138
4-bromo-2-chloro-6-[(6-phenyl-2,3-dihydroindol-1-yl)sulfonyl]phenol (PubChem CID 146565138) has the molecular formula C20H15BrClNO3S and a molecular weight of 464.77 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[(6-phenyl-2,3-dihydroindol-1-yl)sulfonyl]phenol.
| Compound Name | 4-bromo-2-chloro-6-[(6-phenyl-2,3-dihydroindol-1-yl)sulfonyl]phenol |
|---|---|
| PubChem CID | 146565138 |
| Molecular Formula | C20H15BrClNO3S |
| Molecular Weight | 464.77 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 4-bromo-2-chloro-6-[(6-phenyl-2,3-dihydroindol-1-yl)sulfonyl]phenol |
| SMILES | O=S(=O)(c1cc(Br)cc(Cl)c1O)N1CCc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C20H15BrClNO3S/c21-16-11-17(22)20(24)19(12-16)27(25,26)23-9-8-14-6-7-15(10-18(14)23)13-4-2-1-3-5-13/h1-7,10-12,24H,8-9H2 |
| InChIKey | URABVUPNBVVWPW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|