C21H16Cl2FNO3S — CID 146601700
3,5-dichloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 146601700) has the molecular formula C21H16Cl2FNO3S and a molecular weight of 452.33 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 146601700 |
| Molecular Formula | C21H16Cl2FNO3S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 3,5-dichloro-N-(2-fluoro-5-phenylphenyl)-2-hydroxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1cc(-c2ccccc2)ccc1F)S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C21H16Cl2FNO3S/c1-2-10-25(29(27,28)20-13-16(22)12-17(23)21(20)26)19-11-15(8-9-18(19)24)14-6-4-3-5-7-14/h2-9,11-13,26H,1,10H2 |
| InChIKey | MNDCXZNCAFMUFI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|