C14H19FN2O3 — CID 146550167
methyl 4-(5-fluoro-3-pyridinyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxylate (PubChem CID 146550167) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 4-(5-fluoro-3-pyridinyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 4-(5-fluoro-3-pyridinyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 146550167 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 4-(5-fluoro-3-pyridinyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxylate |
| SMILES | COCCN1CC(C(=O)OC)C(c2cncc(F)c2)C1 |
| InChI | InChI=1S/C14H19FN2O3/c1-19-4-3-17-8-12(13(9-17)14(18)20-2)10-5-11(15)7-16-6-10/h5-7,12-13H,3-4,8-9H2,1-2H3 |
| InChIKey | HXUWSTPHYGZALH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |