C23H28FNO3 — CID 146550514
(Z)-5-(3-fluoro-4-methylphenyl)-4-(4-methyl-2,3-dihydrofuran-5-yl)-2-methylidene-N-(oxan-4-yl)pent-3-enamide (PubChem CID 146550514) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is (Z)-5-(3-fluoro-4-methylphenyl)-4-(4-methyl-2,3-dihydrofuran-5-yl)-2-methylidene-N-(oxan-4-yl)pent-3-enamide.
| Compound Name | (Z)-5-(3-fluoro-4-methylphenyl)-4-(4-methyl-2,3-dihydrofuran-5-yl)-2-methylidene-N-(oxan-4-yl)pent-3-enamide |
|---|---|
| PubChem CID | 146550514 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (Z)-5-(3-fluoro-4-methylphenyl)-4-(4-methyl-2,3-dihydrofuran-5-yl)-2-methylidene-N-(oxan-4-yl)pent-3-enamide |
| SMILES | C=C(/C=C(/Cc1ccc(C)c(F)c1)C1=C(C)CCO1)C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C23H28FNO3/c1-15-4-5-18(14-21(15)24)13-19(22-16(2)6-11-28-22)12-17(3)23(26)25-20-7-9-27-10-8-20/h4-5,12,14,20H,3,6-11,13H2,1-2H3,(H,25,26)/b19-12- |
| InChIKey | HMWZQMMOWLGFKC-UNOMPAQXSA-N |
| XLogP | 4.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|