C8H14N2O3S2 — CID 146552678
3-ethoxy-2-[1-(sulfamoylamino)ethyl]thiophene (PubChem CID 146552678) has the molecular formula C8H14N2O3S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-ethoxy-2-[1-(sulfamoylamino)ethyl]thiophene.
| Compound Name | 3-ethoxy-2-[1-(sulfamoylamino)ethyl]thiophene |
|---|---|
| PubChem CID | 146552678 |
| Molecular Formula | C8H14N2O3S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-ethoxy-2-[1-(sulfamoylamino)ethyl]thiophene |
| SMILES | CCOc1ccsc1C(C)NS(N)(=O)=O |
| InChI | InChI=1S/C8H14N2O3S2/c1-3-13-7-4-5-14-8(7)6(2)10-15(9,11)12/h4-6,10H,3H2,1-2H3,(H2,9,11,12) |
| InChIKey | URLQGRUAVYQARD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |