C14H30N2O2S2 — CID 146552791
1,4-bis(2-propan-2-yloxysulfanylethyl)piperazine (PubChem CID 146552791) has the molecular formula C14H30N2O2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1,4-bis(2-propan-2-yloxysulfanylethyl)piperazine.
| Compound Name | 1,4-bis(2-propan-2-yloxysulfanylethyl)piperazine |
|---|---|
| PubChem CID | 146552791 |
| Molecular Formula | C14H30N2O2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1,4-bis(2-propan-2-yloxysulfanylethyl)piperazine |
| SMILES | CC(C)OSCCN1CCN(CCSOC(C)C)CC1 |
| InChI | InChI=1S/C14H30N2O2S2/c1-13(2)17-19-11-9-15-5-7-16(8-6-15)10-12-20-18-14(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | ZIHUKGZPOMAQQU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|