C13H25NO3 — CID 146560366
2-[[(3S,4R)-4-ethyloxan-3-yl]oxymethyl]-4-methylmorpholine (PubChem CID 146560366) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[[(3S,4R)-4-ethyloxan-3-yl]oxymethyl]-4-methylmorpholine.
| Compound Name | 2-[[(3S,4R)-4-ethyloxan-3-yl]oxymethyl]-4-methylmorpholine |
|---|---|
| PubChem CID | 146560366 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-[[(3S,4R)-4-ethyloxan-3-yl]oxymethyl]-4-methylmorpholine |
| SMILES | CC[C@@H]1CCOC[C@H]1OCC1CN(C)CCO1 |
| InChI | InChI=1S/C13H25NO3/c1-3-11-4-6-15-10-13(11)17-9-12-8-14(2)5-7-16-12/h11-13H,3-10H2,1-2H3/t11-,12?,13-/m1/s1 |
| InChIKey | YBROJENNAAQUDH-LKOMHFJYSA-N |
| XLogP | 1.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |