C17H12BrN3O2 — CID 146560642
N-(6-bromo-3-oxo-1,2-dihydroindol-2-yl)-1H-indole-2-carboxamide (PubChem CID 146560642) has the molecular formula C17H12BrN3O2 and a molecular weight of 370.21 g/mol. Its IUPAC name is N-(6-bromo-3-oxo-1,2-dihydroindol-2-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(6-bromo-3-oxo-1,2-dihydroindol-2-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146560642 |
| Molecular Formula | C17H12BrN3O2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-(6-bromo-3-oxo-1,2-dihydroindol-2-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(NC1Nc2cc(Br)ccc2C1=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H12BrN3O2/c18-10-5-6-11-13(8-10)20-16(15(11)22)21-17(23)14-7-9-3-1-2-4-12(9)19-14/h1-8,16,19-20H,(H,21,23) |
| InChIKey | WKJMEDFGJSABJY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |