C28H34N8O2 — CID 146561117
N-[2-[(2R)-2,4-dimethylpiperazin-1-yl]-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 146561117) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[2-[(2R)-2,4-dimethylpiperazin-1-yl]-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[(2R)-2,4-dimethylpiperazin-1-yl]-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146561117 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[2-[(2R)-2,4-dimethylpiperazin-1-yl]-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | [H]/N=C/c1ccc(-c2cc(Nc3cc(NC(=O)C=C)c(N4CCN(C)C[C@H]4C)cc3OC)ncn2)cc1NC |
| InChI | InChI=1S/C28H34N8O2/c1-6-28(37)34-23-12-24(26(38-5)14-25(23)36-10-9-35(4)16-18(36)2)33-27-13-22(31-17-32-27)19-7-8-20(15-29)21(11-19)30-3/h6-8,11-15,17-18,29-30H,1,9-10,16H2,2-5H3,(H,34,37)(H,31,32,33)/b29-15+/t18-/m1/s1 |
| InChIKey | BPISWYNSJLHIGS-RSXURMKNSA-N |
| XLogP | 4.20 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|