C31H38F2N8O2 — CID 146561753
N-[2-[4-(diethylamino)piperidin-1-yl]-4-(difluoromethoxy)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 146561753) has the molecular formula C31H38F2N8O2 and a molecular weight of 592.70 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)piperidin-1-yl]-4-(difluoromethoxy)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[4-(diethylamino)piperidin-1-yl]-4-(difluoromethoxy)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146561753 |
| Molecular Formula | C31H38F2N8O2 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | N-[2-[4-(diethylamino)piperidin-1-yl]-4-(difluoromethoxy)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | [H]/N=C/c1ccc(-c2cc(Nc3cc(NC(=O)C=C)c(N4CCC(N(CC)CC)CC4)cc3OC(F)F)ncn2)cc1NC |
| InChI | InChI=1S/C31H38F2N8O2/c1-5-30(42)39-25-15-26(38-29-16-24(36-19-37-29)20-8-9-21(18-34)23(14-20)35-4)28(43-31(32)33)17-27(25)41-12-10-22(11-13-41)40(6-2)7-3/h5,8-9,14-19,22,31,34-35H,1,6-7,10-13H2,2-4H3,(H,39,42)(H,36,37,38)/b34-18+ |
| InChIKey | YIGVQZKVJFWUOG-FABQOPTDSA-N |
| XLogP | 5.96 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|