C28H33N8O2+ — CID 170119512
N-[2-(1,6-dimethyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 170119512) has the molecular formula C28H33N8O2+ and a molecular weight of 513.63 g/mol. Its IUPAC name is N-[2-(1,6-dimethyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-(1,6-dimethyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170119512 |
| Molecular Formula | C28H33N8O2+ |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[2-(1,6-dimethyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-5-[[6-[4-methanimidoyl-3-(methylamino)phenyl]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | [H]/N=C/c1ccc(-c2cc(Nc3cc(NC(=O)C=C)c(N4CC[N+](C)=C(C)C4)cc3OC)ncn2)cc1NC |
| InChI | InChI=1S/C28H32N8O2/c1-6-28(37)34-23-12-24(26(38-5)14-25(23)36-10-9-35(4)18(2)16-36)33-27-13-22(31-17-32-27)19-7-8-20(15-29)21(11-19)30-3/h6-8,11-15,17H,1,9-10,16H2,2-5H3,(H3-,29,30,31,32,33,34,37)/p+1 |
| InChIKey | XJCSUOHGZSYDRS-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|