C27H27FN6O2 — CID 146563090
[(1S,5R)-2-azabicyclo[3.1.0]hexan-1-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 146563090) has the molecular formula C27H27FN6O2 and a molecular weight of 486.55 g/mol. Its IUPAC name is [(1S,5R)-2-azabicyclo[3.1.0]hexan-1-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [(1S,5R)-2-azabicyclo[3.1.0]hexan-1-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 146563090 |
| Molecular Formula | C27H27FN6O2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(1S,5R)-2-azabicyclo[3.1.0]hexan-1-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(C(=O)[C@]35C[C@H]3CCN5)CC4)n[nH]c2c1 |
| InChI | InChI=1S/C27H27FN6O2/c1-2-14-10-23(35)19(28)11-18(14)15-3-4-17-21(9-15)32-33-24(17)25-30-20-6-8-34(13-22(20)31-25)26(36)27-12-16(27)5-7-29-27/h3-4,9-11,16,29,35H,2,5-8,12-13H2,1H3,(H,30,31)(H,32,33)/t16-,27+/m1/s1 |
| InChIKey | BANHJUBZDASFPC-JWIGPWBQSA-N |
| XLogP | 3.66 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |