C30H37FN6O — CID 137243682
5-ethyl-2-fluoro-4-[3-[5-[2-(2,2,3,3-tetramethylazetidin-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]phenol (PubChem CID 137243682) has the molecular formula C30H37FN6O and a molecular weight of 516.67 g/mol. Its IUPAC name is 5-ethyl-2-fluoro-4-[3-[5-[2-(2,2,3,3-tetramethylazetidin-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]phenol.
| Compound Name | 5-ethyl-2-fluoro-4-[3-[5-[2-(2,2,3,3-tetramethylazetidin-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]phenol |
|---|---|
| PubChem CID | 137243682 |
| Molecular Formula | C30H37FN6O |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 5-ethyl-2-fluoro-4-[3-[5-[2-(2,2,3,3-tetramethylazetidin-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]phenol |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(CCN3CC(C)(C)C3(C)C)CC4)n[nH]c2c1 |
| InChI | InChI=1S/C30H37FN6O/c1-6-18-14-26(38)22(31)15-21(18)19-7-8-20-24(13-19)34-35-27(20)28-32-23-9-10-36(16-25(23)33-28)11-12-37-17-29(2,3)30(37,4)5/h7-8,13-15,38H,6,9-12,16-17H2,1-5H3,(H,32,33)(H,34,35) |
| InChIKey | QDPLVCZHCXNIIH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |