C24H22CmFN6O2- — CID 154689138
CID 154689138 (PubChem CID 154689138) has the molecular formula C24H22CmFN6O2- and a molecular weight of 692.48 g/mol.
| Compound Name | CID 154689138 |
|---|---|
| PubChem CID | 154689138 |
| Molecular Formula | C24H22CmFN6O2- |
| Molecular Weight | 692.48 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | — |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(C(=O)N3C[CH-]C3)C4)n[nH]c2c1.[Cm] |
| InChI | InChI=1S/C24H22FN6O2.Cm/c1-2-13-9-21(32)17(25)10-16(13)14-4-5-15-18(8-14)28-29-22(15)23-26-19-11-31(12-20(19)27-23)24(33)30-6-3-7-30;/h3-5,8-10,32H,2,6-7,11-12H2,1H3,(H,26,27)(H,28,29);/q-1; |
| InChIKey | KCCRRYMTGOFXTB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|