C24H26FN7O4S — CID 146357214
N-[2-[[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]sulfonylamino]ethyl]formamide (PubChem CID 146357214) has the molecular formula C24H26FN7O4S and a molecular weight of 527.58 g/mol. Its IUPAC name is N-[2-[[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]sulfonylamino]ethyl]formamide.
| Compound Name | N-[2-[[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]sulfonylamino]ethyl]formamide |
|---|---|
| PubChem CID | 146357214 |
| Molecular Formula | C24H26FN7O4S |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | N-[2-[[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]sulfonylamino]ethyl]formamide |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(S(=O)(=O)NCCNC=O)CC4)n[nH]c2c1 |
| InChI | InChI=1S/C24H26FN7O4S/c1-2-14-10-22(34)18(25)11-17(14)15-3-4-16-20(9-15)30-31-23(16)24-28-19-5-8-32(12-21(19)29-24)37(35,36)27-7-6-26-13-33/h3-4,9-11,13,27,34H,2,5-8,12H2,1H3,(H,26,33)(H,28,29)(H,30,31) |
| InChIKey | FRZWUMCUBVWGJC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|