C29H35FN6O3 — CID 145306138
2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbaldehyde;N-methyl-1-(oxan-4-yl)methanamine (PubChem CID 145306138) has the molecular formula C29H35FN6O3 and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbaldehyde;N-methyl-1-(oxan-4-yl)methanamine.
| Compound Name | 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbaldehyde;N-methyl-1-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 145306138 |
| Molecular Formula | C29H35FN6O3 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbaldehyde;N-methyl-1-(oxan-4-yl)methanamine |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(C=O)CC4)n[nH]c2c1.CNCC1CCOCC1 |
| InChI | InChI=1S/C22H20FN5O2.C7H15NO/c1-2-12-8-20(30)16(23)9-15(12)13-3-4-14-18(7-13)26-27-21(14)22-24-17-5-6-28(11-29)10-19(17)25-22;1-8-6-7-2-4-9-5-3-7/h3-4,7-9,11,30H,2,5-6,10H2,1H3,(H,24,25)(H,26,27);7-8H,2-6H2,1H3 |
| InChIKey | GSJJYHDOBOZYJT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|