C34H53N9O3 — CID 146565896
1-butan-2-yl-4-[[3-[(1-decan-5-yltriazol-4-yl)methoxy]-5-[(1-pentan-2-yltriazol-4-yl)methoxy]phenoxy]methyl]triazole (PubChem CID 146565896) has the molecular formula C34H53N9O3 and a molecular weight of 635.86 g/mol. Its IUPAC name is 1-butan-2-yl-4-[[3-[(1-decan-5-yltriazol-4-yl)methoxy]-5-[(1-pentan-2-yltriazol-4-yl)methoxy]phenoxy]methyl]triazole.
| Compound Name | 1-butan-2-yl-4-[[3-[(1-decan-5-yltriazol-4-yl)methoxy]-5-[(1-pentan-2-yltriazol-4-yl)methoxy]phenoxy]methyl]triazole |
|---|---|
| PubChem CID | 146565896 |
| Molecular Formula | C34H53N9O3 |
| Molecular Weight | 635.86 g/mol |
| Exact Mass | 635.43 |
| IUPAC Name | 1-butan-2-yl-4-[[3-[(1-decan-5-yltriazol-4-yl)methoxy]-5-[(1-pentan-2-yltriazol-4-yl)methoxy]phenoxy]methyl]triazole |
| SMILES | CCCCCC(CCCC)n1cc(COc2cc(OCc3cn(C(C)CC)nn3)cc(OCc3cn(C(C)CCC)nn3)c2)nn1 |
| InChI | InChI=1S/C34H53N9O3/c1-7-11-13-16-31(15-12-8-2)43-22-30(37-40-43)25-46-34-18-32(44-23-28-20-41(38-35-28)26(5)10-4)17-33(19-34)45-24-29-21-42(39-36-29)27(6)14-9-3/h17-22,26-27,31H,7-16,23-25H2,1-6H3 |
| InChIKey | PPLQQHFJILHSOC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.86 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|