C42H77N5 — CID 138698762
2-[[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazol-4-yl]methyl]-1,1-dimethylhydrazine (PubChem CID 138698762) has the molecular formula C42H77N5 and a molecular weight of 652.11 g/mol. Its IUPAC name is 2-[[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazol-4-yl]methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazol-4-yl]methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 138698762 |
| Molecular Formula | C42H77N5 |
| Molecular Weight | 652.11 g/mol |
| Exact Mass | 651.62 |
| IUPAC Name | 2-[[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazol-4-yl]methyl]-1,1-dimethylhydrazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)n1cc(CNN(C)C)nn1 |
| InChI | InChI=1S/C42H77N5/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(47-40-41(44-45-47)39-43-46(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40,42-43H,5-12,17-18,23-39H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | AQDUHWXTWQMWCY-KWXKLSQISA-N |
| XLogP | 12.79 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.11 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|