C41H73N3 — CID 130350688
4-ethyl-1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazole (PubChem CID 130350688) has the molecular formula C41H73N3 and a molecular weight of 608.06 g/mol. Its IUPAC name is 4-ethyl-1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazole.
| Compound Name | 4-ethyl-1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazole |
|---|---|
| PubChem CID | 130350688 |
| Molecular Formula | C41H73N3 |
| Molecular Weight | 608.06 g/mol |
| Exact Mass | 607.58 |
| IUPAC Name | 4-ethyl-1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]triazole |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)n1cc(CC)nn1 |
| InChI | InChI=1S/C41H73N3/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(44-39-40(6-3)42-43-44)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,39,41H,4-12,17-18,23-38H2,1-3H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | UYKOWWSERWQMKK-KWXKLSQISA-N |
| XLogP | 13.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.06 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|