C15H19N3O2 — CID 146567941
N,3-dimethyl-4-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 146567941) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N,3-dimethyl-4-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | N,3-dimethyl-4-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 146567941 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N,3-dimethyl-4-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CNc1ccc(-c2nc(C3CCOCC3)no2)c(C)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-9-12(16-2)3-4-13(10)15-17-14(18-20-15)11-5-7-19-8-6-11/h3-4,9,11,16H,5-8H2,1-2H3 |
| InChIKey | XUSRRCVXNZGIHK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |