C19H19N3O5 — CID 146569290
(11S)-5-methoxy-6-phenylmethoxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione (PubChem CID 146569290) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (11S)-5-methoxy-6-phenylmethoxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione.
| Compound Name | (11S)-5-methoxy-6-phenylmethoxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione |
|---|---|
| PubChem CID | 146569290 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (11S)-5-methoxy-6-phenylmethoxy-13-oxa-1,7,9-triazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-2,10-dione |
| SMILES | COc1cc2c(nc1OCc1ccccc1)NC(=O)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C19H19N3O5/c1-25-15-9-13-16(21-18(15)27-10-12-5-3-2-4-6-12)20-17(23)14-11-26-8-7-22(14)19(13)24/h2-6,9,14H,7-8,10-11H2,1H3,(H,20,21,23)/t14-/m0/s1 |
| InChIKey | GXSKRCLKUXYGJM-AWEZNQCLSA-N |
| XLogP | 1.46 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |