C24H22N2O4 — CID 134566290
(12aS)-8-methoxy-9-phenylmethoxy-11,12a,13,13a-tetrahydro-4aH-indolo[2,1-c][1,4]benzodiazepine-6,12-dione (PubChem CID 134566290) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (12aS)-8-methoxy-9-phenylmethoxy-11,12a,13,13a-tetrahydro-4aH-indolo[2,1-c][1,4]benzodiazepine-6,12-dione.
| Compound Name | (12aS)-8-methoxy-9-phenylmethoxy-11,12a,13,13a-tetrahydro-4aH-indolo[2,1-c][1,4]benzodiazepine-6,12-dione |
|---|---|
| PubChem CID | 134566290 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (12aS)-8-methoxy-9-phenylmethoxy-11,12a,13,13a-tetrahydro-4aH-indolo[2,1-c][1,4]benzodiazepine-6,12-dione |
| SMILES | COc1cc2c(cc1OCc1ccccc1)NC(=O)[C@@H]1CC3C=CC=CC3N1C2=O |
| InChI | InChI=1S/C24H22N2O4/c1-29-21-12-17-18(13-22(21)30-14-15-7-3-2-4-8-15)25-23(27)20-11-16-9-5-6-10-19(16)26(20)24(17)28/h2-10,12-13,16,19-20H,11,14H2,1H3,(H,25,27)/t16?,19?,20-/m0/s1 |
| InChIKey | ZAZYVFWNPDJPDK-GQOXECLESA-N |
| XLogP | 3.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |