C24H24N2O3 — CID 163854733
(12aS)-8-methoxy-9-phenylmethoxy-4a,11,12,12a,13,13a-hexahydroindolo[2,1-c][1,4]benzodiazepin-6-one (PubChem CID 163854733) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (12aS)-8-methoxy-9-phenylmethoxy-4a,11,12,12a,13,13a-hexahydroindolo[2,1-c][1,4]benzodiazepin-6-one.
| Compound Name | (12aS)-8-methoxy-9-phenylmethoxy-4a,11,12,12a,13,13a-hexahydroindolo[2,1-c][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 163854733 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (12aS)-8-methoxy-9-phenylmethoxy-4a,11,12,12a,13,13a-hexahydroindolo[2,1-c][1,4]benzodiazepin-6-one |
| SMILES | COc1cc2c(cc1OCc1ccccc1)NC[C@@H]1CC3C=CC=CC3N1C2=O |
| InChI | InChI=1S/C24H24N2O3/c1-28-22-12-19-20(13-23(22)29-15-16-7-3-2-4-8-16)25-14-18-11-17-9-5-6-10-21(17)26(18)24(19)27/h2-10,12-13,17-18,21,25H,11,14-15H2,1H3/t17?,18-,21?/m0/s1 |
| InChIKey | OXIXFMDTHCPVRZ-WBTXTPOCSA-N |
| XLogP | 4.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|