C19H20FN3O2S — CID 146570707
N,N-dibenzyl-1-ethyl-4-fluoropyrazole-3-sulfonamide (PubChem CID 146570707) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is N,N-dibenzyl-1-ethyl-4-fluoropyrazole-3-sulfonamide.
| Compound Name | N,N-dibenzyl-1-ethyl-4-fluoropyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 146570707 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N,N-dibenzyl-1-ethyl-4-fluoropyrazole-3-sulfonamide |
| SMILES | CCn1cc(F)c(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H20FN3O2S/c1-2-22-15-18(20)19(21-22)26(24,25)23(13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17/h3-12,15H,2,13-14H2,1H3 |
| InChIKey | UTBMJDKLWNPFQU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |