C14H10N4O2S — CID 146572291
3-(4,5-didehydropyridin-3-yl)-4-(2-hydroxy-6-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 146572291) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 3-(4,5-didehydropyridin-3-yl)-4-(2-hydroxy-6-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4,5-didehydropyridin-3-yl)-4-(2-hydroxy-6-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 146572291 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-(4,5-didehydropyridin-3-yl)-4-(2-hydroxy-6-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(O)c1-n1c(-c2c#ccnc2)n[nH]c1=S |
| InChI | InChI=1S/C14H10N4O2S/c1-20-11-6-2-5-10(19)12(11)18-13(16-17-14(18)21)9-4-3-7-15-8-9/h2,5-8,19H,1H3,(H,17,21) |
| InChIKey | ZREYCOBXJOZGRF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|