C20H16N4O2S — CID 143627901
3-(5-amino-7-hydroxycyclohepta-1,6-dien-3-yn-1-yl)-4-(5-methoxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 143627901) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-(5-amino-7-hydroxycyclohepta-1,6-dien-3-yn-1-yl)-4-(5-methoxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-amino-7-hydroxycyclohepta-1,6-dien-3-yn-1-yl)-4-(5-methoxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 143627901 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-(5-amino-7-hydroxycyclohepta-1,6-dien-3-yn-1-yl)-4-(5-methoxynaphthalen-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc2c(-n3c(C4=CC#CC(N)C=C4O)n[nH]c3=S)cccc12 |
| InChI | InChI=1S/C20H16N4O2S/c1-26-18-10-4-6-13-14(18)7-3-9-16(13)24-19(22-23-20(24)27)15-8-2-5-12(21)11-17(15)25/h3-4,6-12,25H,21H2,1H3,(H,23,27) |
| InChIKey | YJJAWADSTZOOQJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|