C17H21N3O5 — CID 146573386
tert-butyl 3-(2,6-dioxopiperidin-3-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate (PubChem CID 146573386) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is tert-butyl 3-(2,6-dioxopiperidin-3-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-(2,6-dioxopiperidin-3-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 146573386 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl 3-(2,6-dioxopiperidin-3-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(OC3CCC(=O)NC3=O)cnc2C1 |
| InChI | InChI=1S/C17H21N3O5/c1-17(2,3)25-16(23)20-8-10-6-11(7-18-12(10)9-20)24-13-4-5-14(21)19-15(13)22/h6-7,13H,4-5,8-9H2,1-3H3,(H,19,21,22) |
| InChIKey | GRVNDNPWVROMLS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|