C17H20N6O3 — CID 146575761
N-[(2S)-4-methyl-1-oxo-1-[2-(pyridine-4-carbonyl)hydrazinyl]pentan-2-yl]pyrazine-2-carboxamide (PubChem CID 146575761) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-oxo-1-[2-(pyridine-4-carbonyl)hydrazinyl]pentan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-4-methyl-1-oxo-1-[2-(pyridine-4-carbonyl)hydrazinyl]pentan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146575761 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[(2S)-4-methyl-1-oxo-1-[2-(pyridine-4-carbonyl)hydrazinyl]pentan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cnccn1)C(=O)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H20N6O3/c1-11(2)9-13(21-16(25)14-10-19-7-8-20-14)17(26)23-22-15(24)12-3-5-18-6-4-12/h3-8,10-11,13H,9H2,1-2H3,(H,21,25)(H,22,24)(H,23,26)/t13-/m0/s1 |
| InChIKey | MAYKZUWPUMMGJT-ZDUSSCGKSA-N |
| XLogP | 0.48 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|