C24H36N4 — CID 146576710
N'-[[(2S)-4-cyclohexa-2,4-dien-1-ylpyrrolidin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine (PubChem CID 146576710) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is N'-[[(2S)-4-cyclohexa-2,4-dien-1-ylpyrrolidin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine.
| Compound Name | N'-[[(2S)-4-cyclohexa-2,4-dien-1-ylpyrrolidin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 146576710 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | N'-[[(2S)-4-cyclohexa-2,4-dien-1-ylpyrrolidin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
| SMILES | NCCCCN(C[C@@H]1CC(C2C=CC=CC2)CN1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C24H36N4/c25-13-4-5-15-28(23-12-6-10-20-11-7-14-26-24(20)23)18-22-16-21(17-27-22)19-8-2-1-3-9-19/h1-3,7-8,11,14,19,21-23,27H,4-6,9-10,12-13,15-18,25H2/t19?,21?,22-,23-/m0/s1 |
| InChIKey | CKAIHVIXLFFUKO-VZKWCCSDSA-N |
| XLogP | 3.61 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|