C25H31N3O5S — CID 146582525
N-[3-(ethoxymethyl)-3-hydroxypentyl]-N-methyl-4-(quinolin-8-ylsulfonylamino)benzamide (PubChem CID 146582525) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[3-(ethoxymethyl)-3-hydroxypentyl]-N-methyl-4-(quinolin-8-ylsulfonylamino)benzamide.
| Compound Name | N-[3-(ethoxymethyl)-3-hydroxypentyl]-N-methyl-4-(quinolin-8-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 146582525 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[3-(ethoxymethyl)-3-hydroxypentyl]-N-methyl-4-(quinolin-8-ylsulfonylamino)benzamide |
| SMILES | CCOCC(O)(CC)CCN(C)C(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C25H31N3O5S/c1-4-25(30,18-33-5-2)15-17-28(3)24(29)20-11-13-21(14-12-20)27-34(31,32)22-10-6-8-19-9-7-16-26-23(19)22/h6-14,16,27,30H,4-5,15,17-18H2,1-3H3 |
| InChIKey | KHIJTWKLEUZHBP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |