C22H27NO2 — CID 146583797
(8R,9S,13S,14S,17S)-3-(2-iminobut-3-ynoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 146583797) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-(2-iminobut-3-ynoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-(2-iminobut-3-ynoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 146583797 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-(2-iminobut-3-ynoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | [H]/N=C(\C#C)COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C22H27NO2/c1-3-15(23)13-25-16-5-7-17-14(12-16)4-6-19-18(17)10-11-22(2)20(19)8-9-21(22)24/h1,5,7,12,18-21,23-24H,4,6,8-11,13H2,2H3/b23-15+/t18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | UJFHQTIQMJBRCJ-YJBRMXMQSA-N |
| XLogP | 3.94 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|