C12H14N2 — CID 146587176
2-(4,6-dimethylcyclohexa-1,3-dien-1-yl)pyrimidine (PubChem CID 146587176) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(4,6-dimethylcyclohexa-1,3-dien-1-yl)pyrimidine.
| Compound Name | 2-(4,6-dimethylcyclohexa-1,3-dien-1-yl)pyrimidine |
|---|---|
| PubChem CID | 146587176 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(4,6-dimethylcyclohexa-1,3-dien-1-yl)pyrimidine |
| SMILES | CC1=CC=C(c2ncccn2)C(C)C1 |
| InChI | InChI=1S/C12H14N2/c1-9-4-5-11(10(2)8-9)12-13-6-3-7-14-12/h3-7,10H,8H2,1-2H3 |
| InChIKey | GPBBEMYEASQQNX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |