C22H30N2O5S — CID 146587938
(2S)-2-amino-N-[(2S)-3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methylsulfonylphenyl)propanamide (PubChem CID 146587938) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methylsulfonylphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 146587938 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methylsulfonylphenyl)propanamide |
| SMILES | CC1(C(=O)[C@H](CC2=CCCCC2)NC(=O)[C@@H](N)Cc2ccc(S(C)(=O)=O)cc2)CO1 |
| InChI | InChI=1S/C22H30N2O5S/c1-22(14-29-22)20(25)19(13-15-6-4-3-5-7-15)24-21(26)18(23)12-16-8-10-17(11-9-16)30(2,27)28/h6,8-11,18-19H,3-5,7,12-14,23H2,1-2H3,(H,24,26)/t18-,19-,22?/m0/s1 |
| InChIKey | RTFXKOPMYGCBQW-NVPCEHRXSA-N |
| XLogP | 1.69 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|