C31H43N3O6 — CID 157425875
2-(cyclohexen-1-ylmethyl)-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-5-[(2-morpholin-4-ylacetyl)amino]-4-oxohexanamide (PubChem CID 157425875) has the molecular formula C31H43N3O6 and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-(cyclohexen-1-ylmethyl)-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-5-[(2-morpholin-4-ylacetyl)amino]-4-oxohexanamide.
| Compound Name | 2-(cyclohexen-1-ylmethyl)-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-5-[(2-morpholin-4-ylacetyl)amino]-4-oxohexanamide |
|---|---|
| PubChem CID | 157425875 |
| Molecular Formula | C31H43N3O6 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 2-(cyclohexen-1-ylmethyl)-N-[1-(2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl]-5-[(2-morpholin-4-ylacetyl)amino]-4-oxohexanamide |
| SMILES | CC(NC(=O)CN1CCOCC1)C(=O)CC(CC1=CCCCC1)C(=O)NC(Cc1ccccc1)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C31H43N3O6/c1-22(32-28(36)20-34-13-15-39-16-14-34)27(35)19-25(17-23-9-5-3-6-10-23)30(38)33-26(29(37)31(2)21-40-31)18-24-11-7-4-8-12-24/h4,7-9,11-12,22,25-26H,3,5-6,10,13-21H2,1-2H3,(H,32,36)(H,33,38) |
| InChIKey | PUTMUKZOGDVAIU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|