C22H34N4O6 — CID 144719378
N-[2-[[(2S)-3-(cyclopenten-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide (PubChem CID 144719378) has the molecular formula C22H34N4O6 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[2-[[(2S)-3-(cyclopenten-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide.
| Compound Name | N-[2-[[(2S)-3-(cyclopenten-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 144719378 |
| Molecular Formula | C22H34N4O6 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-[2-[[(2S)-3-(cyclopenten-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide |
| SMILES | CC(NC(=O)CN1CCOCC1)C(=O)NCC(=O)N[C@@H](CC1=CCCC1)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C22H34N4O6/c1-15(24-19(28)13-26-7-9-31-10-8-26)21(30)23-12-18(27)25-17(11-16-5-3-4-6-16)20(29)22(2)14-32-22/h5,15,17H,3-4,6-14H2,1-2H3,(H,23,30)(H,24,28)(H,25,27)/t15?,17-,22?/m0/s1 |
| InChIKey | MYCSQKISIGPMPV-YSJWXEPDSA-N |
| XLogP | -0.72 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|