C23H36N4O6 — CID 144719535
(2S)-N-[2-[[(2S)-3-(cyclohexen-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide (PubChem CID 144719535) has the molecular formula C23H36N4O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (2S)-N-[2-[[(2S)-3-(cyclohexen-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide.
| Compound Name | (2S)-N-[2-[[(2S)-3-(cyclohexen-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 144719535 |
| Molecular Formula | C23H36N4O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (2S)-N-[2-[[(2S)-3-(cyclohexen-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide |
| SMILES | C[C@H](NC(=O)CN1CCOCC1)C(=O)NCC(=O)N[C@@H](CC1=CCCCC1)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C23H36N4O6/c1-16(25-20(29)14-27-8-10-32-11-9-27)22(31)24-13-19(28)26-18(21(30)23(2)15-33-23)12-17-6-4-3-5-7-17/h6,16,18H,3-5,7-15H2,1-2H3,(H,24,31)(H,25,29)(H,26,28)/t16-,18-,23+/m0/s1 |
| InChIKey | BIHYMUVHQAZOMI-TXBYWVTISA-N |
| XLogP | -0.33 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|