C27H48N4O6 — CID 144719331
N-[2-[[3-cyclopentyl-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide;ethane;prop-1-ene (PubChem CID 144719331) has the molecular formula C27H48N4O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is N-[2-[[3-cyclopentyl-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide;ethane;prop-1-ene.
| Compound Name | N-[2-[[3-cyclopentyl-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144719331 |
| Molecular Formula | C27H48N4O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | N-[2-[[3-cyclopentyl-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-2-[(2-morpholin-4-ylacetyl)amino]propanamide;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC(NC(=O)CN1CCOCC1)C(=O)NCC(=O)NC(CC1CCCC1)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C22H36N4O6.C3H6.C2H6/c1-15(24-19(28)13-26-7-9-31-10-8-26)21(30)23-12-18(27)25-17(11-16-5-3-4-6-16)20(29)22(2)14-32-22;1-3-2;1-2/h15-17H,3-14H2,1-2H3,(H,23,30)(H,24,28)(H,25,27);3H,1H2,2H3;1-2H3 |
| InChIKey | KSJVXRFJGVQXLU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|