C22H32N10OS — CID 146588699
2-methyl-6-[[2-[2-[methyl-[2-methyl-6-[(4-methylfuran-3-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]ethyl]thiophen-3-yl]methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 146588699) has the molecular formula C22H32N10OS and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-methyl-6-[[2-[2-[methyl-[2-methyl-6-[(4-methylfuran-3-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]ethyl]thiophen-3-yl]methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 2-methyl-6-[[2-[2-[methyl-[2-methyl-6-[(4-methylfuran-3-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]ethyl]thiophen-3-yl]methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 146588699 |
| Molecular Formula | C22H32N10OS |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-methyl-6-[[2-[2-[methyl-[2-methyl-6-[(4-methylfuran-3-yl)methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]ethyl]thiophen-3-yl]methylimino]-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | Cc1cocc1C/N=C1/NC(N(C)CCc2sccc2C/N=C2\NC(N)=NC(C)N2)=NC(C)N1 |
| InChI | InChI=1S/C22H32N10OS/c1-13-11-33-12-17(13)10-25-21-28-15(3)29-22(31-21)32(4)7-5-18-16(6-8-34-18)9-24-20-27-14(2)26-19(23)30-20/h6,8,11-12,14-15H,5,7,9-10H2,1-4H3,(H2,25,28,29,31)(H4,23,24,26,27,30) |
| InChIKey | IRRRFJMBJXBZFF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|