C18H24N2O4 — CID 146589302
tert-butyl 6-(4-aminobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 146589302) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 6-(4-aminobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-(4-aminobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 146589302 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl 6-(4-aminobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(OC(=O)c3ccc(N)cc3)C1C2 |
| InChI | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(22)20-10-11-8-14(20)15(9-11)23-16(21)12-4-6-13(19)7-5-12/h4-7,11,14-15H,8-10,19H2,1-3H3 |
| InChIKey | DYXFHTWIJRHFIP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|